C12H15NO5S — CID 65379594
ethyl 6-sulfamoyl-3,4-dihydro-2H-chromene-4-carboxylate (PubChem CID 65379594) has the molecular formula C12H15NO5S and a molecular weight of 285.32 g/mol. Its IUPAC name is ethyl 6-sulfamoyl-3,4-dihydro-2H-chromene-4-carboxylate.
| Compound Name | ethyl 6-sulfamoyl-3,4-dihydro-2H-chromene-4-carboxylate |
|---|---|
| PubChem CID | 65379594 |
| Molecular Formula | C12H15NO5S |
| Molecular Weight | 285.32 g/mol |
| Exact Mass | 285.07 |
| IUPAC Name | ethyl 6-sulfamoyl-3,4-dihydro-2H-chromene-4-carboxylate |
| SMILES | CCOC(=O)C1CCOc2ccc(S(N)(=O)=O)cc21 |
| InChI | InChI=1S/C12H15NO5S/c1-2-17-12(14)9-5-6-18-11-4-3-8(7-10(9)11)19(13,15)16/h3-4,7,9H,2,5-6H2,1H3,(H2,13,15,16) |
| InChIKey | SSXYOWMHWIGYDA-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 95.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.32 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |