C10H8Cl2O3 — CID 22481669
methyl 2,3-dichloro-2,3-dihydro-1-benzofuran-6-carboxylate (PubChem CID 22481669) has the molecular formula C10H8Cl2O3 and a molecular weight of 247.08 g/mol. Its IUPAC name is methyl 2,3-dichloro-2,3-dihydro-1-benzofuran-6-carboxylate.
| Compound Name | methyl 2,3-dichloro-2,3-dihydro-1-benzofuran-6-carboxylate |
|---|---|
| PubChem CID | 22481669 |
| Molecular Formula | C10H8Cl2O3 |
| Molecular Weight | 247.08 g/mol |
| Exact Mass | 245.99 |
| IUPAC Name | methyl 2,3-dichloro-2,3-dihydro-1-benzofuran-6-carboxylate |
| SMILES | COC(=O)c1ccc2c(c1)OC(Cl)C2Cl |
| InChI | InChI=1S/C10H8Cl2O3/c1-14-10(13)5-2-3-6-7(4-5)15-9(12)8(6)11/h2-4,8-9H,1H3 |
| InChIKey | IKCRVOFAKQFICG-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.08 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|