methyl 2,3-dichloro-2,3-dihydro-1-benzofuran-6-carboxylate

C10H8Cl2O3 — CID 22481669

IUPACmethyl 2,3-dichloro-2,3-dihydro-1-benzofuran-6-carboxylate
SMILESCOC(=O)c1ccc2c(c1)OC(Cl)C2Cl
InChIInChI=1S/C10H8Cl2O3/c1-14-10(13)5-2-3-6-7(4-5)15-9(12)8(6)11/h2-4,8-9H,1H3
InChIKeyIKCRVOFAKQFICG-UHFFFAOYSA-N
MW247.08 g/mol
LogP2.71
Rot. Bonds1

About methyl 2,3-dichloro-2,3-dihydro-1-benzofuran-6-carboxylate

methyl 2,3-dichloro-2,3-dihydro-1-benzofuran-6-carboxylate (PubChem CID 22481669) has the molecular formula C10H8Cl2O3 and a molecular weight of 247.08 g/mol. Its IUPAC name is methyl 2,3-dichloro-2,3-dihydro-1-benzofuran-6-carboxylate.

Molecular Properties

Compound Namemethyl 2,3-dichloro-2,3-dihydro-1-benzofuran-6-carboxylate
PubChem CID22481669
Molecular FormulaC10H8Cl2O3
Molecular Weight247.08 g/mol
Exact Mass245.99
IUPAC Namemethyl 2,3-dichloro-2,3-dihydro-1-benzofuran-6-carboxylate
SMILESCOC(=O)c1ccc2c(c1)OC(Cl)C2Cl
InChIInChI=1S/C10H8Cl2O3/c1-14-10(13)5-2-3-6-7(4-5)15-9(12)8(6)11/h2-4,8-9H,1H3
InChIKeyIKCRVOFAKQFICG-UHFFFAOYSA-N
XLogP2.71
TPSA35.53 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500247.08
LogP ≤ 52.71
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'alkyl_halide', 'substructure': 'N/A'}

Analyze methyl 2,3-dichloro-2,3-dihydro-1-benzofuran-6-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2,3-dichloro-2,3-dihydro-1-benzofuran-6-carboxylate?
The IUPAC name of methyl 2,3-dichloro-2,3-dihydro-1-benzofuran-6-carboxylate (CID 22481669) is methyl 2,3-dichloro-2,3-dihydro-1-benzofuran-6-carboxylate.
What is the SMILES notation for methyl 2,3-dichloro-2,3-dihydro-1-benzofuran-6-carboxylate?
The canonical SMILES for methyl 2,3-dichloro-2,3-dihydro-1-benzofuran-6-carboxylate is COC(=O)c1ccc2c(c1)OC(Cl)C2Cl.
What is the InChIKey of methyl 2,3-dichloro-2,3-dihydro-1-benzofuran-6-carboxylate?
The InChIKey is IKCRVOFAKQFICG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8Cl2O3/c1-14-10(13)5-2-3-6-7(4-5)15-9(12)8(6)11/h2-4,8-9H,1H3.
What are the key properties of methyl 2,3-dichloro-2,3-dihydro-1-benzofuran-6-carboxylate?
methyl 2,3-dichloro-2,3-dihydro-1-benzofuran-6-carboxylate has a molecular weight of 247.08 g/mol, XLogP of 2.71, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2,3-dichloro-2,3-dihydro-1-benzofuran-6-carboxylate is sourced from PubChem (CID 22481669), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).