C11H12ClNO4 — CID 83318590
methyl 4-[(2-chloroacetyl)amino]-3-methoxybenzoate (PubChem CID 83318590) has the molecular formula C11H12ClNO4 and a molecular weight of 257.67 g/mol. Its IUPAC name is methyl 4-[(2-chloroacetyl)amino]-3-methoxybenzoate.
| Compound Name | methyl 4-[(2-chloroacetyl)amino]-3-methoxybenzoate |
|---|---|
| PubChem CID | 83318590 |
| Molecular Formula | C11H12ClNO4 |
| Molecular Weight | 257.67 g/mol |
| Exact Mass | 257.05 |
| IUPAC Name | methyl 4-[(2-chloroacetyl)amino]-3-methoxybenzoate |
| SMILES | COC(=O)c1ccc(NC(=O)CCl)c(OC)c1 |
| InChI | InChI=1S/C11H12ClNO4/c1-16-9-5-7(11(15)17-2)3-4-8(9)13-10(14)6-12/h3-5H,6H2,1-2H3,(H,13,14) |
| InChIKey | ZKJWYIRSEZWZFF-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.67 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|