C12H15N3O5 — CID 82350119
methyl 4-[(2-aminoacetyl)amino]-3-(2-amino-2-oxoethoxy)benzoate (PubChem CID 82350119) has the molecular formula C12H15N3O5 and a molecular weight of 281.27 g/mol. Its IUPAC name is methyl 4-[(2-aminoacetyl)amino]-3-(2-amino-2-oxoethoxy)benzoate.
| Compound Name | methyl 4-[(2-aminoacetyl)amino]-3-(2-amino-2-oxoethoxy)benzoate |
|---|---|
| PubChem CID | 82350119 |
| Molecular Formula | C12H15N3O5 |
| Molecular Weight | 281.27 g/mol |
| Exact Mass | 281.10 |
| IUPAC Name | methyl 4-[(2-aminoacetyl)amino]-3-(2-amino-2-oxoethoxy)benzoate |
| SMILES | COC(=O)c1ccc(NC(=O)CN)c(OCC(N)=O)c1 |
| InChI | InChI=1S/C12H15N3O5/c1-19-12(18)7-2-3-8(15-11(17)5-13)9(4-7)20-6-10(14)16/h2-4H,5-6,13H2,1H3,(H2,14,16)(H,15,17) |
| InChIKey | YJPQQDLKRLIJLR-UHFFFAOYSA-N |
| XLogP | -0.77 |
| TPSA | 133.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.27 |
| LogP ≤ 5 | -0.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |