C25H34N8O6 — CID 54755367
methyl 4-[[4-acetamido-3-[3-(diaminomethylideneamino)propoxy]benzoyl]amino]-3-[3-(diaminomethylideneamino)propoxy]benzoate (PubChem CID 54755367) has the molecular formula C25H34N8O6 and a molecular weight of 542.60 g/mol. Its IUPAC name is methyl 4-[[4-acetamido-3-[3-(diaminomethylideneamino)propoxy]benzoyl]amino]-3-[3-(diaminomethylideneamino)propoxy]benzoate.
| Compound Name | methyl 4-[[4-acetamido-3-[3-(diaminomethylideneamino)propoxy]benzoyl]amino]-3-[3-(diaminomethylideneamino)propoxy]benzoate |
|---|---|
| PubChem CID | 54755367 |
| Molecular Formula | C25H34N8O6 |
| Molecular Weight | 542.60 g/mol |
| Exact Mass | 542.26 |
| IUPAC Name | methyl 4-[[4-acetamido-3-[3-(diaminomethylideneamino)propoxy]benzoyl]amino]-3-[3-(diaminomethylideneamino)propoxy]benzoate |
| SMILES | COC(=O)c1ccc(NC(=O)c2ccc(NC(C)=O)c(OCCCN=C(N)N)c2)c(OCCCN=C(N)N)c1 |
| InChI | InChI=1S/C25H34N8O6/c1-15(34)32-18-7-5-16(13-20(18)38-11-3-9-30-24(26)27)22(35)33-19-8-6-17(23(36)37-2)14-21(19)39-12-4-10-31-25(28)29/h5-8,13-14H,3-4,9-12H2,1-2H3,(H,32,34)(H,33,35)(H4,26,27,30)(H4,28,29,31) |
| InChIKey | KMCPDSUAUQXVAG-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 231.76 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.60 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|