C16H13N3O4S — CID 122150755
methyl 4-(2,1,3-benzothiadiazole-5-carbonylamino)-3-methoxybenzoate (PubChem CID 122150755) has the molecular formula C16H13N3O4S and a molecular weight of 343.36 g/mol. Its IUPAC name is methyl 4-(2,1,3-benzothiadiazole-5-carbonylamino)-3-methoxybenzoate.
| Compound Name | methyl 4-(2,1,3-benzothiadiazole-5-carbonylamino)-3-methoxybenzoate |
|---|---|
| PubChem CID | 122150755 |
| Molecular Formula | C16H13N3O4S |
| Molecular Weight | 343.36 g/mol |
| Exact Mass | 343.06 |
| IUPAC Name | methyl 4-(2,1,3-benzothiadiazole-5-carbonylamino)-3-methoxybenzoate |
| SMILES | COC(=O)c1ccc(NC(=O)c2ccc3nsnc3c2)c(OC)c1 |
| InChI | InChI=1S/C16H13N3O4S/c1-22-14-8-10(16(21)23-2)4-6-12(14)17-15(20)9-3-5-11-13(7-9)19-24-18-11/h3-8H,1-2H3,(H,17,20) |
| InChIKey | ANJHVFCTTWMTBO-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 90.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.36 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |