C13H7BrClN3OS — CID 17313577
N-(4-bromo-2-chlorophenyl)-2,1,3-benzothiadiazole-5-carboxamide (PubChem CID 17313577) has the molecular formula C13H7BrClN3OS and a molecular weight of 368.64 g/mol. Its IUPAC name is N-(4-bromo-2-chlorophenyl)-2,1,3-benzothiadiazole-5-carboxamide.
| Compound Name | N-(4-bromo-2-chlorophenyl)-2,1,3-benzothiadiazole-5-carboxamide |
|---|---|
| PubChem CID | 17313577 |
| Molecular Formula | C13H7BrClN3OS |
| Molecular Weight | 368.64 g/mol |
| Exact Mass | 366.92 |
| IUPAC Name | N-(4-bromo-2-chlorophenyl)-2,1,3-benzothiadiazole-5-carboxamide |
| SMILES | O=C(Nc1ccc(Br)cc1Cl)c1ccc2nsnc2c1 |
| InChI | InChI=1S/C13H7BrClN3OS/c14-8-2-4-10(9(15)6-8)16-13(19)7-1-3-11-12(5-7)18-20-17-11/h1-6H,(H,16,19) |
| InChIKey | ZHRTYVOIENFOAW-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.64 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |