C16H15N3OS — CID 17274164
N-(4-propan-2-ylphenyl)-2,1,3-benzothiadiazole-5-carboxamide (PubChem CID 17274164) has the molecular formula C16H15N3OS and a molecular weight of 297.38 g/mol. Its IUPAC name is N-(4-propan-2-ylphenyl)-2,1,3-benzothiadiazole-5-carboxamide.
| Compound Name | N-(4-propan-2-ylphenyl)-2,1,3-benzothiadiazole-5-carboxamide |
|---|---|
| PubChem CID | 17274164 |
| Molecular Formula | C16H15N3OS |
| Molecular Weight | 297.38 g/mol |
| Exact Mass | 297.09 |
| IUPAC Name | N-(4-propan-2-ylphenyl)-2,1,3-benzothiadiazole-5-carboxamide |
| SMILES | CC(C)c1ccc(NC(=O)c2ccc3nsnc3c2)cc1 |
| InChI | InChI=1S/C16H15N3OS/c1-10(2)11-3-6-13(7-4-11)17-16(20)12-5-8-14-15(9-12)19-21-18-14/h3-10H,1-2H3,(H,17,20) |
| InChIKey | QOCRBSKZDXHSRR-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.38 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |