C13H8FN3OS — CID 17099097
N-(3-fluorophenyl)-2,1,3-benzothiadiazole-5-carboxamide (PubChem CID 17099097) has the molecular formula C13H8FN3OS and a molecular weight of 273.29 g/mol. Its IUPAC name is N-(3-fluorophenyl)-2,1,3-benzothiadiazole-5-carboxamide.
| Compound Name | N-(3-fluorophenyl)-2,1,3-benzothiadiazole-5-carboxamide |
|---|---|
| PubChem CID | 17099097 |
| Molecular Formula | C13H8FN3OS |
| Molecular Weight | 273.29 g/mol |
| Exact Mass | 273.04 |
| IUPAC Name | N-(3-fluorophenyl)-2,1,3-benzothiadiazole-5-carboxamide |
| SMILES | O=C(Nc1cccc(F)c1)c1ccc2nsnc2c1 |
| InChI | InChI=1S/C13H8FN3OS/c14-9-2-1-3-10(7-9)15-13(18)8-4-5-11-12(6-8)17-19-16-11/h1-7H,(H,15,18) |
| InChIKey | QBKPXLCHEWINTI-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.29 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |