C14H16N2O4 — CID 82350205
methyl 4-(3-aminopropanoylamino)-3-prop-2-ynoxybenzoate (PubChem CID 82350205) has the molecular formula C14H16N2O4 and a molecular weight of 276.29 g/mol. Its IUPAC name is methyl 4-(3-aminopropanoylamino)-3-prop-2-ynoxybenzoate.
| Compound Name | methyl 4-(3-aminopropanoylamino)-3-prop-2-ynoxybenzoate |
|---|---|
| PubChem CID | 82350205 |
| Molecular Formula | C14H16N2O4 |
| Molecular Weight | 276.29 g/mol |
| Exact Mass | 276.11 |
| IUPAC Name | methyl 4-(3-aminopropanoylamino)-3-prop-2-ynoxybenzoate |
| SMILES | C#CCOc1cc(C(=O)OC)ccc1NC(=O)CCN |
| InChI | InChI=1S/C14H16N2O4/c1-3-8-20-12-9-10(14(18)19-2)4-5-11(12)16-13(17)6-7-15/h1,4-5,9H,6-8,15H2,2H3,(H,16,17) |
| InChIKey | ZZXDFXNVQORZBC-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.29 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|