C12H12N2O4 — CID 82534092
prop-2-ynyl 4-[(2-aminoacetyl)amino]-3-hydroxybenzoate (PubChem CID 82534092) has the molecular formula C12H12N2O4 and a molecular weight of 248.24 g/mol. Its IUPAC name is prop-2-ynyl 4-[(2-aminoacetyl)amino]-3-hydroxybenzoate.
| Compound Name | prop-2-ynyl 4-[(2-aminoacetyl)amino]-3-hydroxybenzoate |
|---|---|
| PubChem CID | 82534092 |
| Molecular Formula | C12H12N2O4 |
| Molecular Weight | 248.24 g/mol |
| Exact Mass | 248.08 |
| IUPAC Name | prop-2-ynyl 4-[(2-aminoacetyl)amino]-3-hydroxybenzoate |
| SMILES | C#CCOC(=O)c1ccc(NC(=O)CN)c(O)c1 |
| InChI | InChI=1S/C12H12N2O4/c1-2-5-18-12(17)8-3-4-9(10(15)6-8)14-11(16)7-13/h1,3-4,6,15H,5,7,13H2,(H,14,16) |
| InChIKey | UZKPLKBYQOXNNA-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 101.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.24 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|