C11H10F3NO4S — CID 75392071
methyl 3-hydroxy-4-[[2-(trifluoromethylsulfanyl)acetyl]amino]benzoate (PubChem CID 75392071) has the molecular formula C11H10F3NO4S and a molecular weight of 309.27 g/mol. Its IUPAC name is methyl 3-hydroxy-4-[[2-(trifluoromethylsulfanyl)acetyl]amino]benzoate.
| Compound Name | methyl 3-hydroxy-4-[[2-(trifluoromethylsulfanyl)acetyl]amino]benzoate |
|---|---|
| PubChem CID | 75392071 |
| Molecular Formula | C11H10F3NO4S |
| Molecular Weight | 309.27 g/mol |
| Exact Mass | 309.03 |
| IUPAC Name | methyl 3-hydroxy-4-[[2-(trifluoromethylsulfanyl)acetyl]amino]benzoate |
| SMILES | COC(=O)c1ccc(NC(=O)CSC(F)(F)F)c(O)c1 |
| InChI | InChI=1S/C11H10F3NO4S/c1-19-10(18)6-2-3-7(8(16)4-6)15-9(17)5-20-11(12,13)14/h2-4,16H,5H2,1H3,(H,15,17) |
| InChIKey | NNKDUTPBJZNEEI-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.27 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|