C18H16ClNO5 — CID 108744924
methyl 4-[[4-(4-chlorophenyl)-4-oxobutanoyl]amino]-3-hydroxybenzoate (PubChem CID 108744924) has the molecular formula C18H16ClNO5 and a molecular weight of 361.78 g/mol. Its IUPAC name is methyl 4-[[4-(4-chlorophenyl)-4-oxobutanoyl]amino]-3-hydroxybenzoate.
| Compound Name | methyl 4-[[4-(4-chlorophenyl)-4-oxobutanoyl]amino]-3-hydroxybenzoate |
|---|---|
| PubChem CID | 108744924 |
| Molecular Formula | C18H16ClNO5 |
| Molecular Weight | 361.78 g/mol |
| Exact Mass | 361.07 |
| IUPAC Name | methyl 4-[[4-(4-chlorophenyl)-4-oxobutanoyl]amino]-3-hydroxybenzoate |
| SMILES | COC(=O)c1ccc(NC(=O)CCC(=O)c2ccc(Cl)cc2)c(O)c1 |
| InChI | InChI=1S/C18H16ClNO5/c1-25-18(24)12-4-7-14(16(22)10-12)20-17(23)9-8-15(21)11-2-5-13(19)6-3-11/h2-7,10,22H,8-9H2,1H3,(H,20,23) |
| InChIKey | CXDMNOINESBQDX-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.78 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|