C20H22Cl2N2O4 — CID 4135027
3-chloro-N-[4-[4-(3-chloropropanoylamino)-3-methoxyphenyl]-2-methoxyphenyl]propanamide (PubChem CID 4135027) has the molecular formula C20H22Cl2N2O4 and a molecular weight of 425.31 g/mol. Its IUPAC name is 3-chloro-N-[4-[4-(3-chloropropanoylamino)-3-methoxyphenyl]-2-methoxyphenyl]propanamide.
| Compound Name | 3-chloro-N-[4-[4-(3-chloropropanoylamino)-3-methoxyphenyl]-2-methoxyphenyl]propanamide |
|---|---|
| PubChem CID | 4135027 |
| Molecular Formula | C20H22Cl2N2O4 |
| Molecular Weight | 425.31 g/mol |
| Exact Mass | 424.10 |
| IUPAC Name | 3-chloro-N-[4-[4-(3-chloropropanoylamino)-3-methoxyphenyl]-2-methoxyphenyl]propanamide |
| SMILES | COc1cc(-c2ccc(NC(=O)CCCl)c(OC)c2)ccc1NC(=O)CCCl |
| InChI | InChI=1S/C20H22Cl2N2O4/c1-27-17-11-13(3-5-15(17)23-19(25)7-9-21)14-4-6-16(18(12-14)28-2)24-20(26)8-10-22/h3-6,11-12H,7-10H2,1-2H3,(H,23,25)(H,24,26) |
| InChIKey | SXLKVUAFYMXVAQ-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.31 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|