C10H12ClNO4 — CID 91138680
2-chloro-N-(4-hydroxy-2,5-dimethoxyphenyl)acetamide (PubChem CID 91138680) has the molecular formula C10H12ClNO4 and a molecular weight of 245.66 g/mol. Its IUPAC name is 2-chloro-N-(4-hydroxy-2,5-dimethoxyphenyl)acetamide.
| Compound Name | 2-chloro-N-(4-hydroxy-2,5-dimethoxyphenyl)acetamide |
|---|---|
| PubChem CID | 91138680 |
| Molecular Formula | C10H12ClNO4 |
| Molecular Weight | 245.66 g/mol |
| Exact Mass | 245.05 |
| IUPAC Name | 2-chloro-N-(4-hydroxy-2,5-dimethoxyphenyl)acetamide |
| SMILES | COc1cc(NC(=O)CCl)c(OC)cc1O |
| InChI | InChI=1S/C10H12ClNO4/c1-15-8-4-7(13)9(16-2)3-6(8)12-10(14)5-11/h3-4,13H,5H2,1-2H3,(H,12,14) |
| InChIKey | GZWJIJQVRCCJJV-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.66 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|