C15H17ClN2O5 — CID 23513212
N-[2-chloro-5-methoxy-4-(3-oxobutanoylamino)phenyl]-3-oxobutanamide (PubChem CID 23513212) has the molecular formula C15H17ClN2O5 and a molecular weight of 340.76 g/mol. Its IUPAC name is N-[2-chloro-5-methoxy-4-(3-oxobutanoylamino)phenyl]-3-oxobutanamide.
| Compound Name | N-[2-chloro-5-methoxy-4-(3-oxobutanoylamino)phenyl]-3-oxobutanamide |
|---|---|
| PubChem CID | 23513212 |
| Molecular Formula | C15H17ClN2O5 |
| Molecular Weight | 340.76 g/mol |
| Exact Mass | 340.08 |
| IUPAC Name | N-[2-chloro-5-methoxy-4-(3-oxobutanoylamino)phenyl]-3-oxobutanamide |
| SMILES | COc1cc(NC(=O)CC(C)=O)c(Cl)cc1NC(=O)CC(C)=O |
| InChI | InChI=1S/C15H17ClN2O5/c1-8(19)4-14(21)17-11-7-13(23-3)12(6-10(11)16)18-15(22)5-9(2)20/h6-7H,4-5H2,1-3H3,(H,17,21)(H,18,22) |
| InChIKey | TXHAXWRTTSMTDH-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.76 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|