C14H20ClNO3 — CID 43040630
N-(2-chloro-4,5-dimethoxyphenyl)-4-methylpentanamide (PubChem CID 43040630) has the molecular formula C14H20ClNO3 and a molecular weight of 285.77 g/mol. Its IUPAC name is N-(2-chloro-4,5-dimethoxyphenyl)-4-methylpentanamide.
| Compound Name | N-(2-chloro-4,5-dimethoxyphenyl)-4-methylpentanamide |
|---|---|
| PubChem CID | 43040630 |
| Molecular Formula | C14H20ClNO3 |
| Molecular Weight | 285.77 g/mol |
| Exact Mass | 285.11 |
| IUPAC Name | N-(2-chloro-4,5-dimethoxyphenyl)-4-methylpentanamide |
| SMILES | COc1cc(Cl)c(NC(=O)CCC(C)C)cc1OC |
| InChI | InChI=1S/C14H20ClNO3/c1-9(2)5-6-14(17)16-11-8-13(19-4)12(18-3)7-10(11)15/h7-9H,5-6H2,1-4H3,(H,16,17) |
| InChIKey | RIPDCMQXLLTRAY-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.77 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |