C14H19ClO3 — CID 43340681
1-(2-chloro-4,5-dimethoxyphenyl)-4-methylpentan-1-one (PubChem CID 43340681) has the molecular formula C14H19ClO3 and a molecular weight of 270.76 g/mol. Its IUPAC name is 1-(2-chloro-4,5-dimethoxyphenyl)-4-methylpentan-1-one.
| Compound Name | 1-(2-chloro-4,5-dimethoxyphenyl)-4-methylpentan-1-one |
|---|---|
| PubChem CID | 43340681 |
| Molecular Formula | C14H19ClO3 |
| Molecular Weight | 270.76 g/mol |
| Exact Mass | 270.10 |
| IUPAC Name | 1-(2-chloro-4,5-dimethoxyphenyl)-4-methylpentan-1-one |
| SMILES | COc1cc(Cl)c(C(=O)CCC(C)C)cc1OC |
| InChI | InChI=1S/C14H19ClO3/c1-9(2)5-6-12(16)10-7-13(17-3)14(18-4)8-11(10)15/h7-9H,5-6H2,1-4H3 |
| InChIKey | ADUPNYKLLGNLDT-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.76 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |