C12H12Cl2O2 — CID 146009948
1-(2,4-dichloro-5-methoxyphenyl)pent-4-en-1-one (PubChem CID 146009948) has the molecular formula C12H12Cl2O2 and a molecular weight of 259.13 g/mol. Its IUPAC name is 1-(2,4-dichloro-5-methoxyphenyl)pent-4-en-1-one.
| Compound Name | 1-(2,4-dichloro-5-methoxyphenyl)pent-4-en-1-one |
|---|---|
| PubChem CID | 146009948 |
| Molecular Formula | C12H12Cl2O2 |
| Molecular Weight | 259.13 g/mol |
| Exact Mass | 258.02 |
| IUPAC Name | 1-(2,4-dichloro-5-methoxyphenyl)pent-4-en-1-one |
| SMILES | C=CCCC(=O)c1cc(OC)c(Cl)cc1Cl |
| InChI | InChI=1S/C12H12Cl2O2/c1-3-4-5-11(15)8-6-12(16-2)10(14)7-9(8)13/h3,6-7H,1,4-5H2,2H3 |
| InChIKey | BXNBJCOUUCTRGD-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.13 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|