C10H9Cl3O2 — CID 82627725
3-chloro-1-(4,5-dichloro-2-methoxyphenyl)propan-1-one (PubChem CID 82627725) has the molecular formula C10H9Cl3O2 and a molecular weight of 267.54 g/mol. Its IUPAC name is 3-chloro-1-(4,5-dichloro-2-methoxyphenyl)propan-1-one.
| Compound Name | 3-chloro-1-(4,5-dichloro-2-methoxyphenyl)propan-1-one |
|---|---|
| PubChem CID | 82627725 |
| Molecular Formula | C10H9Cl3O2 |
| Molecular Weight | 267.54 g/mol |
| Exact Mass | 265.97 |
| IUPAC Name | 3-chloro-1-(4,5-dichloro-2-methoxyphenyl)propan-1-one |
| SMILES | COc1cc(Cl)c(Cl)cc1C(=O)CCCl |
| InChI | InChI=1S/C10H9Cl3O2/c1-15-10-5-8(13)7(12)4-6(10)9(14)2-3-11/h4-5H,2-3H2,1H3 |
| InChIKey | FIKRMPRDWZMDFR-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.54 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|