C12H12Cl2O4 — CID 82553971
methyl 4-(4,5-dichloro-2-methoxyphenyl)-4-oxobutanoate (PubChem CID 82553971) has the molecular formula C12H12Cl2O4 and a molecular weight of 291.13 g/mol. Its IUPAC name is methyl 4-(4,5-dichloro-2-methoxyphenyl)-4-oxobutanoate.
| Compound Name | methyl 4-(4,5-dichloro-2-methoxyphenyl)-4-oxobutanoate |
|---|---|
| PubChem CID | 82553971 |
| Molecular Formula | C12H12Cl2O4 |
| Molecular Weight | 291.13 g/mol |
| Exact Mass | 290.01 |
| IUPAC Name | methyl 4-(4,5-dichloro-2-methoxyphenyl)-4-oxobutanoate |
| SMILES | COC(=O)CCC(=O)c1cc(Cl)c(Cl)cc1OC |
| InChI | InChI=1S/C12H12Cl2O4/c1-17-11-6-9(14)8(13)5-7(11)10(15)3-4-12(16)18-2/h5-6H,3-4H2,1-2H3 |
| InChIKey | HSROZPRTAQEMEB-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.13 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |