methyl 4-(4,5-dichloro-2-methoxyphenyl)-4-oxobutanoate

C12H12Cl2O4 — CID 82553971

IUPACmethyl 4-(4,5-dichloro-2-methoxyphenyl)-4-oxobutanoate
SMILESCOC(=O)CCC(=O)c1cc(Cl)c(Cl)cc1OC
InChIInChI=1S/C12H12Cl2O4/c1-17-11-6-9(14)8(13)5-7(11)10(15)3-4-12(16)18-2/h5-6H,3-4H2,1-2H3
InChIKeyHSROZPRTAQEMEB-UHFFFAOYSA-N
MW291.13 g/mol
LogP3.14
Rot. Bonds5

About methyl 4-(4,5-dichloro-2-methoxyphenyl)-4-oxobutanoate

methyl 4-(4,5-dichloro-2-methoxyphenyl)-4-oxobutanoate (PubChem CID 82553971) has the molecular formula C12H12Cl2O4 and a molecular weight of 291.13 g/mol. Its IUPAC name is methyl 4-(4,5-dichloro-2-methoxyphenyl)-4-oxobutanoate.

Molecular Properties

Compound Namemethyl 4-(4,5-dichloro-2-methoxyphenyl)-4-oxobutanoate
PubChem CID82553971
Molecular FormulaC12H12Cl2O4
Molecular Weight291.13 g/mol
Exact Mass290.01
IUPAC Namemethyl 4-(4,5-dichloro-2-methoxyphenyl)-4-oxobutanoate
SMILESCOC(=O)CCC(=O)c1cc(Cl)c(Cl)cc1OC
InChIInChI=1S/C12H12Cl2O4/c1-17-11-6-9(14)8(13)5-7(11)10(15)3-4-12(16)18-2/h5-6H,3-4H2,1-2H3
InChIKeyHSROZPRTAQEMEB-UHFFFAOYSA-N
XLogP3.14
TPSA52.60 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds5
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500291.13
LogP ≤ 53.14
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Analyze methyl 4-(4,5-dichloro-2-methoxyphenyl)-4-oxobutanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 4-(4,5-dichloro-2-methoxyphenyl)-4-oxobutanoate?
The IUPAC name of methyl 4-(4,5-dichloro-2-methoxyphenyl)-4-oxobutanoate (CID 82553971) is methyl 4-(4,5-dichloro-2-methoxyphenyl)-4-oxobutanoate.
What is the SMILES notation for methyl 4-(4,5-dichloro-2-methoxyphenyl)-4-oxobutanoate?
The canonical SMILES for methyl 4-(4,5-dichloro-2-methoxyphenyl)-4-oxobutanoate is COC(=O)CCC(=O)c1cc(Cl)c(Cl)cc1OC.
What is the InChIKey of methyl 4-(4,5-dichloro-2-methoxyphenyl)-4-oxobutanoate?
The InChIKey is HSROZPRTAQEMEB-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12Cl2O4/c1-17-11-6-9(14)8(13)5-7(11)10(15)3-4-12(16)18-2/h5-6H,3-4H2,1-2H3.
What are the key properties of methyl 4-(4,5-dichloro-2-methoxyphenyl)-4-oxobutanoate?
methyl 4-(4,5-dichloro-2-methoxyphenyl)-4-oxobutanoate has a molecular weight of 291.13 g/mol, XLogP of 3.14, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-(4,5-dichloro-2-methoxyphenyl)-4-oxobutanoate is sourced from PubChem (CID 82553971), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).