methyl 4-(2-chloro-3,4-dimethoxyphenyl)-4-oxobutanoate

C13H15ClO5 — CID 63631326

IUPACmethyl 4-(2-chloro-3,4-dimethoxyphenyl)-4-oxobutanoate
SMILESCOC(=O)CCC(=O)c1ccc(OC)c(OC)c1Cl
InChIInChI=1S/C13H15ClO5/c1-17-10-6-4-8(12(14)13(10)19-3)9(15)5-7-11(16)18-2/h4,6H,5,7H2,1-3H3
InChIKeyGTHWLCARSJOOGR-UHFFFAOYSA-N
MW286.71 g/mol
LogP2.49
Rot. Bonds6

About methyl 4-(2-chloro-3,4-dimethoxyphenyl)-4-oxobutanoate

methyl 4-(2-chloro-3,4-dimethoxyphenyl)-4-oxobutanoate (PubChem CID 63631326) has the molecular formula C13H15ClO5 and a molecular weight of 286.71 g/mol. Its IUPAC name is methyl 4-(2-chloro-3,4-dimethoxyphenyl)-4-oxobutanoate.

Molecular Properties

Compound Namemethyl 4-(2-chloro-3,4-dimethoxyphenyl)-4-oxobutanoate
PubChem CID63631326
Molecular FormulaC13H15ClO5
Molecular Weight286.71 g/mol
Exact Mass286.06
IUPAC Namemethyl 4-(2-chloro-3,4-dimethoxyphenyl)-4-oxobutanoate
SMILESCOC(=O)CCC(=O)c1ccc(OC)c(OC)c1Cl
InChIInChI=1S/C13H15ClO5/c1-17-10-6-4-8(12(14)13(10)19-3)9(15)5-7-11(16)18-2/h4,6H,5,7H2,1-3H3
InChIKeyGTHWLCARSJOOGR-UHFFFAOYSA-N
XLogP2.49
TPSA61.83 Ų
H-Bond Donors
H-Bond Acceptors5
Rotatable Bonds6
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500286.71
LogP ≤ 52.49
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 105

Analyze methyl 4-(2-chloro-3,4-dimethoxyphenyl)-4-oxobutanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 4-(2-chloro-3,4-dimethoxyphenyl)-4-oxobutanoate?
The IUPAC name of methyl 4-(2-chloro-3,4-dimethoxyphenyl)-4-oxobutanoate (CID 63631326) is methyl 4-(2-chloro-3,4-dimethoxyphenyl)-4-oxobutanoate.
What is the SMILES notation for methyl 4-(2-chloro-3,4-dimethoxyphenyl)-4-oxobutanoate?
The canonical SMILES for methyl 4-(2-chloro-3,4-dimethoxyphenyl)-4-oxobutanoate is COC(=O)CCC(=O)c1ccc(OC)c(OC)c1Cl.
What is the InChIKey of methyl 4-(2-chloro-3,4-dimethoxyphenyl)-4-oxobutanoate?
The InChIKey is GTHWLCARSJOOGR-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15ClO5/c1-17-10-6-4-8(12(14)13(10)19-3)9(15)5-7-11(16)18-2/h4,6H,5,7H2,1-3H3.
What are the key properties of methyl 4-(2-chloro-3,4-dimethoxyphenyl)-4-oxobutanoate?
methyl 4-(2-chloro-3,4-dimethoxyphenyl)-4-oxobutanoate has a molecular weight of 286.71 g/mol, XLogP of 2.49, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-(2-chloro-3,4-dimethoxyphenyl)-4-oxobutanoate is sourced from PubChem (CID 63631326), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).