C13H15ClO5 — CID 63631326
methyl 4-(2-chloro-3,4-dimethoxyphenyl)-4-oxobutanoate (PubChem CID 63631326) has the molecular formula C13H15ClO5 and a molecular weight of 286.71 g/mol. Its IUPAC name is methyl 4-(2-chloro-3,4-dimethoxyphenyl)-4-oxobutanoate.
| Compound Name | methyl 4-(2-chloro-3,4-dimethoxyphenyl)-4-oxobutanoate |
|---|---|
| PubChem CID | 63631326 |
| Molecular Formula | C13H15ClO5 |
| Molecular Weight | 286.71 g/mol |
| Exact Mass | 286.06 |
| IUPAC Name | methyl 4-(2-chloro-3,4-dimethoxyphenyl)-4-oxobutanoate |
| SMILES | COC(=O)CCC(=O)c1ccc(OC)c(OC)c1Cl |
| InChI | InChI=1S/C13H15ClO5/c1-17-10-6-4-8(12(14)13(10)19-3)9(15)5-7-11(16)18-2/h4,6H,5,7H2,1-3H3 |
| InChIKey | GTHWLCARSJOOGR-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.71 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |