C9H9Cl2NO3 — CID 106892052
(1Z)-2-chloro-N-hydroxy-3,4-dimethoxybenzenecarboximidoyl chloride (PubChem CID 106892052) has the molecular formula C9H9Cl2NO3 and a molecular weight of 250.08 g/mol. Its IUPAC name is (1Z)-2-chloro-N-hydroxy-3,4-dimethoxybenzenecarboximidoyl chloride.
| Compound Name | (1Z)-2-chloro-N-hydroxy-3,4-dimethoxybenzenecarboximidoyl chloride |
|---|---|
| PubChem CID | 106892052 |
| Molecular Formula | C9H9Cl2NO3 |
| Molecular Weight | 250.08 g/mol |
| Exact Mass | 249.00 |
| IUPAC Name | (1Z)-2-chloro-N-hydroxy-3,4-dimethoxybenzenecarboximidoyl chloride |
| SMILES | COc1ccc(/C(Cl)=N/O)c(Cl)c1OC |
| InChI | InChI=1S/C9H9Cl2NO3/c1-14-6-4-3-5(9(11)12-13)7(10)8(6)15-2/h3-4,13H,1-2H3/b12-9- |
| InChIKey | XNWMJPGFKUOHAX-XFXZXTDPSA-N |
| XLogP | 2.73 |
| TPSA | 51.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.08 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|