C9H10ClNO3 — CID 106892044
(1Z)-N-hydroxy-2,3-dimethoxybenzenecarboximidoyl chloride (PubChem CID 106892044) has the molecular formula C9H10ClNO3 and a molecular weight of 215.64 g/mol. Its IUPAC name is (1Z)-N-hydroxy-2,3-dimethoxybenzenecarboximidoyl chloride.
| Compound Name | (1Z)-N-hydroxy-2,3-dimethoxybenzenecarboximidoyl chloride |
|---|---|
| PubChem CID | 106892044 |
| Molecular Formula | C9H10ClNO3 |
| Molecular Weight | 215.64 g/mol |
| Exact Mass | 215.03 |
| IUPAC Name | (1Z)-N-hydroxy-2,3-dimethoxybenzenecarboximidoyl chloride |
| SMILES | COc1cccc(/C(Cl)=N/O)c1OC |
| InChI | InChI=1S/C9H10ClNO3/c1-13-7-5-3-4-6(8(7)14-2)9(10)11-12/h3-5,12H,1-2H3/b11-9- |
| InChIKey | OSUNXCDPHNBUCZ-LUAWRHEFSA-N |
| XLogP | 2.08 |
| TPSA | 51.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.64 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|