C10H15N3O2 — CID 61363434
N-amino-2,3-dimethoxy-N'-methylbenzenecarboximidamide (PubChem CID 61363434) has the molecular formula C10H15N3O2 and a molecular weight of 209.25 g/mol. Its IUPAC name is N-amino-2,3-dimethoxy-N'-methylbenzenecarboximidamide.
| Compound Name | N-amino-2,3-dimethoxy-N'-methylbenzenecarboximidamide |
|---|---|
| PubChem CID | 61363434 |
| Molecular Formula | C10H15N3O2 |
| Molecular Weight | 209.25 g/mol |
| Exact Mass | 209.12 |
| IUPAC Name | N-amino-2,3-dimethoxy-N'-methylbenzenecarboximidamide |
| SMILES | C/N=C(\NN)c1cccc(OC)c1OC |
| InChI | InChI=1S/C10H15N3O2/c1-12-10(13-11)7-5-4-6-8(14-2)9(7)15-3/h4-6H,11H2,1-3H3,(H,12,13) |
| InChIKey | XZSKOUUIGNFGDF-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 68.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.25 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|