C9H13NO4 — CID 141005510
2,3-dimethoxybenzamide;hydrate (PubChem CID 141005510) has the molecular formula C9H13NO4 and a molecular weight of 199.21 g/mol. Its IUPAC name is 2,3-dimethoxybenzamide;hydrate.
| Compound Name | 2,3-dimethoxybenzamide;hydrate |
|---|---|
| PubChem CID | 141005510 |
| Molecular Formula | C9H13NO4 |
| Molecular Weight | 199.21 g/mol |
| Exact Mass | 199.08 |
| IUPAC Name | 2,3-dimethoxybenzamide;hydrate |
| SMILES | COc1cccc(C(N)=O)c1OC.O |
| InChI | InChI=1S/C9H11NO3.H2O/c1-12-7-5-3-4-6(9(10)11)8(7)13-2;/h3-5H,1-2H3,(H2,10,11);1H2 |
| InChIKey | WYAAOVQKFXNLDD-UHFFFAOYSA-N |
| XLogP | -0.02 |
| TPSA | 93.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.21 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |