C11H15O6P — CID 86047213
(2,3-dimethoxyphenyl)-dimethoxyphosphorylmethanone (PubChem CID 86047213) has the molecular formula C11H15O6P and a molecular weight of 274.21 g/mol. Its IUPAC name is (2,3-dimethoxyphenyl)-dimethoxyphosphorylmethanone.
| Compound Name | (2,3-dimethoxyphenyl)-dimethoxyphosphorylmethanone |
|---|---|
| PubChem CID | 86047213 |
| Molecular Formula | C11H15O6P |
| Molecular Weight | 274.21 g/mol |
| Exact Mass | 274.06 |
| IUPAC Name | (2,3-dimethoxyphenyl)-dimethoxyphosphorylmethanone |
| SMILES | COc1cccc(C(=O)P(=O)(OC)OC)c1OC |
| InChI | InChI=1S/C11H15O6P/c1-14-9-7-5-6-8(10(9)15-2)11(12)18(13,16-3)17-4/h5-7H,1-4H3 |
| InChIKey | TWJIHILAZWYJDS-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.21 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|