C18H28O8 — CID 139804909
2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethyl 2,3-dimethoxybenzoate (PubChem CID 139804909) has the molecular formula C18H28O8 and a molecular weight of 372.41 g/mol. Its IUPAC name is 2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethyl 2,3-dimethoxybenzoate.
| Compound Name | 2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethyl 2,3-dimethoxybenzoate |
|---|---|
| PubChem CID | 139804909 |
| Molecular Formula | C18H28O8 |
| Molecular Weight | 372.41 g/mol |
| Exact Mass | 372.18 |
| IUPAC Name | 2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethyl 2,3-dimethoxybenzoate |
| SMILES | COCCOCCOCCOCCOC(=O)c1cccc(OC)c1OC |
| InChI | InChI=1S/C18H28O8/c1-20-7-8-23-9-10-24-11-12-25-13-14-26-18(19)15-5-4-6-16(21-2)17(15)22-3/h4-6H,7-14H2,1-3H3 |
| InChIKey | LNOLDNJTKVHWBK-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 81.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.41 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|