C17H24O8 — CID 153260877
1-O-[2-(2-hydroxyethoxy)ethyl] 2-O-[2-(2-methoxyethoxy)ethyl] benzene-1,2-dicarboxylate (PubChem CID 153260877) has the molecular formula C17H24O8 and a molecular weight of 356.37 g/mol. Its IUPAC name is 1-O-[2-(2-hydroxyethoxy)ethyl] 2-O-[2-(2-methoxyethoxy)ethyl] benzene-1,2-dicarboxylate.
| Compound Name | 1-O-[2-(2-hydroxyethoxy)ethyl] 2-O-[2-(2-methoxyethoxy)ethyl] benzene-1,2-dicarboxylate |
|---|---|
| PubChem CID | 153260877 |
| Molecular Formula | C17H24O8 |
| Molecular Weight | 356.37 g/mol |
| Exact Mass | 356.15 |
| IUPAC Name | 1-O-[2-(2-hydroxyethoxy)ethyl] 2-O-[2-(2-methoxyethoxy)ethyl] benzene-1,2-dicarboxylate |
| SMILES | COCCOCCOC(=O)c1ccccc1C(=O)OCCOCCO |
| InChI | InChI=1S/C17H24O8/c1-21-8-9-23-11-13-25-17(20)15-5-3-2-4-14(15)16(19)24-12-10-22-7-6-18/h2-5,18H,6-13H2,1H3 |
| InChIKey | WVFBCAGLZDXYFL-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 100.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.37 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|