C20H30O8 — CID 142688933
bis[3-(3-hydroxypropoxy)propyl] benzene-1,2-dicarboxylate (PubChem CID 142688933) has the molecular formula C20H30O8 and a molecular weight of 398.45 g/mol. Its IUPAC name is bis[3-(3-hydroxypropoxy)propyl] benzene-1,2-dicarboxylate.
| Compound Name | bis[3-(3-hydroxypropoxy)propyl] benzene-1,2-dicarboxylate |
|---|---|
| PubChem CID | 142688933 |
| Molecular Formula | C20H30O8 |
| Molecular Weight | 398.45 g/mol |
| Exact Mass | 398.19 |
| IUPAC Name | bis[3-(3-hydroxypropoxy)propyl] benzene-1,2-dicarboxylate |
| SMILES | O=C(OCCCOCCCO)c1ccccc1C(=O)OCCCOCCCO |
| InChI | InChI=1S/C20H30O8/c21-9-3-11-25-13-5-15-27-19(23)17-7-1-2-8-18(17)20(24)28-16-6-14-26-12-4-10-22/h1-2,7-8,21-22H,3-6,9-16H2 |
| InChIKey | VAASRAVBLKCSBI-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 111.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.45 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|