About sodium;hydride;3-hydroxypropyl naphthalene-1-carboxylate
sodium;hydride;3-hydroxypropyl naphthalene-1-carboxylate (PubChem CID 174690004) has the molecular formula C14H15NaO3
and a molecular weight of 254.26 g/mol. Its IUPAC name is sodium;hydride;3-hydroxypropyl naphthalene-1-carboxylate.
Molecular Properties
| Compound Name | sodium;hydride;3-hydroxypropyl naphthalene-1-carboxylate |
| PubChem CID | 174690004 |
| Molecular Formula | C14H15NaO3 |
| Molecular Weight | 254.26 g/mol |
| Exact Mass | 254.09 |
| IUPAC Name | sodium;hydride;3-hydroxypropyl naphthalene-1-carboxylate |
| SMILES | O=C(OCCCO)c1cccc2ccccc12.[H-].[Na+] |
| InChI | InChI=1S/C14H14O3.Na.H/c15-9-4-10-17-14(16)13-8-3-6-11-5-1-2-7-12(11)13;;/h1-3,5-8,15H,4,9-10H2;;/q;+1;-1 |
| InChIKey | IAHMNNWDIWNWDM-UHFFFAOYSA-N |
| XLogP | -0.50 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.26 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze sodium;hydride;3-hydroxypropyl naphthalene-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;hydride;3-hydroxypropyl naphthalene-1-carboxylate?
The IUPAC name of sodium;hydride;3-hydroxypropyl naphthalene-1-carboxylate (CID 174690004) is sodium;hydride;3-hydroxypropyl naphthalene-1-carboxylate.
What is the SMILES notation for sodium;hydride;3-hydroxypropyl naphthalene-1-carboxylate?
The canonical SMILES for sodium;hydride;3-hydroxypropyl naphthalene-1-carboxylate is O=C(OCCCO)c1cccc2ccccc12.[H-].[Na+].
What is the InChIKey of sodium;hydride;3-hydroxypropyl naphthalene-1-carboxylate?
The InChIKey is IAHMNNWDIWNWDM-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14O3.Na.H/c15-9-4-10-17-14(16)13-8-3-6-11-5-1-2-7-12(11)13;;/h1-3,5-8,15H,4,9-10H2;;/q;+1;-1.
What are the key properties of sodium;hydride;3-hydroxypropyl naphthalene-1-carboxylate?
sodium;hydride;3-hydroxypropyl naphthalene-1-carboxylate has a molecular weight of 254.26 g/mol, XLogP of -0.50, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;hydride;3-hydroxypropyl naphthalene-1-carboxylate is sourced from PubChem (CID 174690004), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).