C17H19NO5S — CID 47066495
2-[3-(benzenesulfonyl)propoxy]-3-methoxybenzamide (PubChem CID 47066495) has the molecular formula C17H19NO5S and a molecular weight of 349.41 g/mol. Its IUPAC name is 2-[3-(benzenesulfonyl)propoxy]-3-methoxybenzamide.
| Compound Name | 2-[3-(benzenesulfonyl)propoxy]-3-methoxybenzamide |
|---|---|
| PubChem CID | 47066495 |
| Molecular Formula | C17H19NO5S |
| Molecular Weight | 349.41 g/mol |
| Exact Mass | 349.10 |
| IUPAC Name | 2-[3-(benzenesulfonyl)propoxy]-3-methoxybenzamide |
| SMILES | COc1cccc(C(N)=O)c1OCCCS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C17H19NO5S/c1-22-15-10-5-9-14(17(18)19)16(15)23-11-6-12-24(20,21)13-7-3-2-4-8-13/h2-5,7-10H,6,11-12H2,1H3,(H2,18,19) |
| InChIKey | BFOJIBZOLDMZKG-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 95.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.41 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|