C8H8Cl2N2O2 — CID 82648135
2,3-dichloro-N'-hydroxy-4-methoxybenzenecarboximidamide (PubChem CID 82648135) has the molecular formula C8H8Cl2N2O2 and a molecular weight of 235.07 g/mol. Its IUPAC name is 2,3-dichloro-N'-hydroxy-4-methoxybenzenecarboximidamide.
| Compound Name | 2,3-dichloro-N'-hydroxy-4-methoxybenzenecarboximidamide |
|---|---|
| PubChem CID | 82648135 |
| Molecular Formula | C8H8Cl2N2O2 |
| Molecular Weight | 235.07 g/mol |
| Exact Mass | 234.00 |
| IUPAC Name | 2,3-dichloro-N'-hydroxy-4-methoxybenzenecarboximidamide |
| SMILES | COc1ccc(/C(N)=N/O)c(Cl)c1Cl |
| InChI | InChI=1S/C8H8Cl2N2O2/c1-14-5-3-2-4(8(11)12-13)6(9)7(5)10/h2-3,13H,1H3,(H2,11,12) |
| InChIKey | YAHKGQODAOGZJG-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 67.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.07 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|