About methyl 3-[(E)-N'-hydroxycarbamimidoyl]-4-methoxybenzoate
methyl 3-[(E)-N'-hydroxycarbamimidoyl]-4-methoxybenzoate (PubChem CID 51063639) has the molecular formula C10H12N2O4
and a molecular weight of 224.22 g/mol. Its IUPAC name is methyl 3-[(E)-N'-hydroxycarbamimidoyl]-4-methoxybenzoate.
Molecular Properties
| Compound Name | methyl 3-[(E)-N'-hydroxycarbamimidoyl]-4-methoxybenzoate |
| PubChem CID | 51063639 |
| Molecular Formula | C10H12N2O4 |
| Molecular Weight | 224.22 g/mol |
| Exact Mass | 224.08 |
| IUPAC Name | methyl 3-[(E)-N'-hydroxycarbamimidoyl]-4-methoxybenzoate |
| SMILES | COC(=O)c1ccc(OC)c(/C(N)=N\O)c1 |
| InChI | InChI=1S/C10H12N2O4/c1-15-8-4-3-6(10(13)16-2)5-7(8)9(11)12-14/h3-5,14H,1-2H3,(H2,11,12) |
| InChIKey | NMLAUBDOPKTXCE-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 94.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.22 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze methyl 3-[(E)-N'-hydroxycarbamimidoyl]-4-methoxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-[(E)-N'-hydroxycarbamimidoyl]-4-methoxybenzoate?
The IUPAC name of methyl 3-[(E)-N'-hydroxycarbamimidoyl]-4-methoxybenzoate (CID 51063639) is methyl 3-[(E)-N'-hydroxycarbamimidoyl]-4-methoxybenzoate.
What is the SMILES notation for methyl 3-[(E)-N'-hydroxycarbamimidoyl]-4-methoxybenzoate?
The canonical SMILES for methyl 3-[(E)-N'-hydroxycarbamimidoyl]-4-methoxybenzoate is COC(=O)c1ccc(OC)c(/C(N)=N\O)c1.
What is the InChIKey of methyl 3-[(E)-N'-hydroxycarbamimidoyl]-4-methoxybenzoate?
The InChIKey is NMLAUBDOPKTXCE-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12N2O4/c1-15-8-4-3-6(10(13)16-2)5-7(8)9(11)12-14/h3-5,14H,1-2H3,(H2,11,12).
What are the key properties of methyl 3-[(E)-N'-hydroxycarbamimidoyl]-4-methoxybenzoate?
methyl 3-[(E)-N'-hydroxycarbamimidoyl]-4-methoxybenzoate has a molecular weight of 224.22 g/mol, XLogP of 0.58, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-[(E)-N'-hydroxycarbamimidoyl]-4-methoxybenzoate is sourced from PubChem (CID 51063639), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).