About methyl 3-(N'-benzylcarbamimidoyl)-4-methoxybenzoate;hydrochloride
methyl 3-(N'-benzylcarbamimidoyl)-4-methoxybenzoate;hydrochloride (PubChem CID 141260181) has the molecular formula C17H19ClN2O3
and a molecular weight of 334.80 g/mol. Its IUPAC name is methyl 3-(N'-benzylcarbamimidoyl)-4-methoxybenzoate;hydrochloride.
Molecular Properties
| Compound Name | methyl 3-(N'-benzylcarbamimidoyl)-4-methoxybenzoate;hydrochloride |
| PubChem CID | 141260181 |
| Molecular Formula | C17H19ClN2O3 |
| Molecular Weight | 334.80 g/mol |
| Exact Mass | 334.11 |
| IUPAC Name | methyl 3-(N'-benzylcarbamimidoyl)-4-methoxybenzoate;hydrochloride |
| SMILES | COC(=O)c1ccc(OC)c(/C(N)=N/Cc2ccccc2)c1.Cl |
| InChI | InChI=1S/C17H18N2O3.ClH/c1-21-15-9-8-13(17(20)22-2)10-14(15)16(18)19-11-12-6-4-3-5-7-12;/h3-10H,11H2,1-2H3,(H2,18,19);1H |
| InChIKey | FVVBUOKWUFWBHW-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.80 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze methyl 3-(N'-benzylcarbamimidoyl)-4-methoxybenzoate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-(N'-benzylcarbamimidoyl)-4-methoxybenzoate;hydrochloride?
The IUPAC name of methyl 3-(N'-benzylcarbamimidoyl)-4-methoxybenzoate;hydrochloride (CID 141260181) is methyl 3-(N'-benzylcarbamimidoyl)-4-methoxybenzoate;hydrochloride.
What is the SMILES notation for methyl 3-(N'-benzylcarbamimidoyl)-4-methoxybenzoate;hydrochloride?
The canonical SMILES for methyl 3-(N'-benzylcarbamimidoyl)-4-methoxybenzoate;hydrochloride is COC(=O)c1ccc(OC)c(/C(N)=N/Cc2ccccc2)c1.Cl.
What is the InChIKey of methyl 3-(N'-benzylcarbamimidoyl)-4-methoxybenzoate;hydrochloride?
The InChIKey is FVVBUOKWUFWBHW-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H18N2O3.ClH/c1-21-15-9-8-13(17(20)22-2)10-14(15)16(18)19-11-12-6-4-3-5-7-12;/h3-10H,11H2,1-2H3,(H2,18,19);1H.
What are the key properties of methyl 3-(N'-benzylcarbamimidoyl)-4-methoxybenzoate;hydrochloride?
methyl 3-(N'-benzylcarbamimidoyl)-4-methoxybenzoate;hydrochloride has a molecular weight of 334.80 g/mol, XLogP of 2.81, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-(N'-benzylcarbamimidoyl)-4-methoxybenzoate;hydrochloride is sourced from PubChem (CID 141260181), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).