C10H17N3O4 — CID 66622428
methyl 4-[(diaminomethylideneamino)methyl]benzoate;dihydrate (PubChem CID 66622428) has the molecular formula C10H17N3O4 and a molecular weight of 243.26 g/mol. Its IUPAC name is methyl 4-[(diaminomethylideneamino)methyl]benzoate;dihydrate.
| Compound Name | methyl 4-[(diaminomethylideneamino)methyl]benzoate;dihydrate |
|---|---|
| PubChem CID | 66622428 |
| Molecular Formula | C10H17N3O4 |
| Molecular Weight | 243.26 g/mol |
| Exact Mass | 243.12 |
| IUPAC Name | methyl 4-[(diaminomethylideneamino)methyl]benzoate;dihydrate |
| SMILES | COC(=O)c1ccc(CN=C(N)N)cc1.O.O |
| InChI | InChI=1S/C10H13N3O2.2H2O/c1-15-9(14)8-4-2-7(3-5-8)6-13-10(11)12;;/h2-5H,6H2,1H3,(H4,11,12,13);2*1H2 |
| InChIKey | NTRZTEIRFMYHSU-UHFFFAOYSA-N |
| XLogP | -1.40 |
| TPSA | 153.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.26 |
| LogP ≤ 5 | -1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|