C24H27N5O3S — CID 58659607
methyl 4-[[2-acetamido-4-[2-[4-[(diaminomethylideneamino)methyl]phenyl]ethyl]-1,3-thiazol-5-yl]methyl]benzoate (PubChem CID 58659607) has the molecular formula C24H27N5O3S and a molecular weight of 465.58 g/mol. Its IUPAC name is methyl 4-[[2-acetamido-4-[2-[4-[(diaminomethylideneamino)methyl]phenyl]ethyl]-1,3-thiazol-5-yl]methyl]benzoate.
| Compound Name | methyl 4-[[2-acetamido-4-[2-[4-[(diaminomethylideneamino)methyl]phenyl]ethyl]-1,3-thiazol-5-yl]methyl]benzoate |
|---|---|
| PubChem CID | 58659607 |
| Molecular Formula | C24H27N5O3S |
| Molecular Weight | 465.58 g/mol |
| Exact Mass | 465.18 |
| IUPAC Name | methyl 4-[[2-acetamido-4-[2-[4-[(diaminomethylideneamino)methyl]phenyl]ethyl]-1,3-thiazol-5-yl]methyl]benzoate |
| SMILES | COC(=O)c1ccc(Cc2sc(NC(C)=O)nc2CCc2ccc(CN=C(N)N)cc2)cc1 |
| InChI | InChI=1S/C24H27N5O3S/c1-15(30)28-24-29-20(12-9-16-3-5-18(6-4-16)14-27-23(25)26)21(33-24)13-17-7-10-19(11-8-17)22(31)32-2/h3-8,10-11H,9,12-14H2,1-2H3,(H4,25,26,27)(H,28,29,30) |
| InChIKey | DUXXBHCFBXURGE-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 132.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.58 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|