C23H29N5O4S2 — CID 143109745
4-[2-[2-acetamido-5-[(Z,2Z)-2-ethylidene-5-methylsulfonylpent-3-enyl]-1,3-thiazol-4-yl]ethyl]-N-(diaminomethylidene)benzamide (PubChem CID 143109745) has the molecular formula C23H29N5O4S2 and a molecular weight of 503.65 g/mol. Its IUPAC name is 4-[2-[2-acetamido-5-[(Z,2Z)-2-ethylidene-5-methylsulfonylpent-3-enyl]-1,3-thiazol-4-yl]ethyl]-N-(diaminomethylidene)benzamide.
| Compound Name | 4-[2-[2-acetamido-5-[(Z,2Z)-2-ethylidene-5-methylsulfonylpent-3-enyl]-1,3-thiazol-4-yl]ethyl]-N-(diaminomethylidene)benzamide |
|---|---|
| PubChem CID | 143109745 |
| Molecular Formula | C23H29N5O4S2 |
| Molecular Weight | 503.65 g/mol |
| Exact Mass | 503.17 |
| IUPAC Name | 4-[2-[2-acetamido-5-[(Z,2Z)-2-ethylidene-5-methylsulfonylpent-3-enyl]-1,3-thiazol-4-yl]ethyl]-N-(diaminomethylidene)benzamide |
| SMILES | C/C=C(\C=C/CS(C)(=O)=O)Cc1sc(NC(C)=O)nc1CCc1ccc(C(=O)N=C(N)N)cc1 |
| InChI | InChI=1S/C23H29N5O4S2/c1-4-16(6-5-13-34(3,31)32)14-20-19(27-23(33-20)26-15(2)29)12-9-17-7-10-18(11-8-17)21(30)28-22(24)25/h4-8,10-11H,9,12-14H2,1-3H3,(H,26,27,29)(H4,24,25,28,30)/b6-5-,16-4+ |
| InChIKey | RDRHSCIYFNDWLK-QRHXCOLQSA-N |
| XLogP | 2.39 |
| TPSA | 157.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.65 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|