C21H21N2O3S2- — CID 174485516
[4-[[2-acetamido-4-(2-phenylethyl)-1,3-thiazol-5-yl]methyl]phenyl]methanesulfinate (PubChem CID 174485516) has the molecular formula C21H21N2O3S2- and a molecular weight of 413.54 g/mol. Its IUPAC name is [4-[[2-acetamido-4-(2-phenylethyl)-1,3-thiazol-5-yl]methyl]phenyl]methanesulfinate.
| Compound Name | [4-[[2-acetamido-4-(2-phenylethyl)-1,3-thiazol-5-yl]methyl]phenyl]methanesulfinate |
|---|---|
| PubChem CID | 174485516 |
| Molecular Formula | C21H21N2O3S2- |
| Molecular Weight | 413.54 g/mol |
| Exact Mass | 413.10 |
| IUPAC Name | [4-[[2-acetamido-4-(2-phenylethyl)-1,3-thiazol-5-yl]methyl]phenyl]methanesulfinate |
| SMILES | CC(=O)Nc1nc(CCc2ccccc2)c(Cc2ccc(CS(=O)[O-])cc2)s1 |
| InChI | InChI=1S/C21H22N2O3S2/c1-15(24)22-21-23-19(12-11-16-5-3-2-4-6-16)20(27-21)13-17-7-9-18(10-8-17)14-28(25)26/h2-10H,11-14H2,1H3,(H,25,26)(H,22,23,24)/p-1 |
| InChIKey | FPOKMMIMAGNRLV-UHFFFAOYSA-M |
| XLogP | 3.86 |
| TPSA | 82.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.54 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|