C24H28N6O2S — CID 87985613
4-[[2-acetamido-4-[2-[4-(hydrazinylmethylideneamino)phenyl]ethyl]-1,3-thiazol-5-yl]methyl]-N,N-dimethylbenzamide (PubChem CID 87985613) has the molecular formula C24H28N6O2S and a molecular weight of 464.60 g/mol. Its IUPAC name is 4-[[2-acetamido-4-[2-[4-(hydrazinylmethylideneamino)phenyl]ethyl]-1,3-thiazol-5-yl]methyl]-N,N-dimethylbenzamide.
| Compound Name | 4-[[2-acetamido-4-[2-[4-(hydrazinylmethylideneamino)phenyl]ethyl]-1,3-thiazol-5-yl]methyl]-N,N-dimethylbenzamide |
|---|---|
| PubChem CID | 87985613 |
| Molecular Formula | C24H28N6O2S |
| Molecular Weight | 464.60 g/mol |
| Exact Mass | 464.20 |
| IUPAC Name | 4-[[2-acetamido-4-[2-[4-(hydrazinylmethylideneamino)phenyl]ethyl]-1,3-thiazol-5-yl]methyl]-N,N-dimethylbenzamide |
| SMILES | CC(=O)Nc1nc(CCc2ccc(/N=C/NN)cc2)c(Cc2ccc(C(=O)N(C)C)cc2)s1 |
| InChI | InChI=1S/C24H28N6O2S/c1-16(31)28-24-29-21(13-8-17-6-11-20(12-7-17)26-15-27-25)22(33-24)14-18-4-9-19(10-5-18)23(32)30(2)3/h4-7,9-12,15H,8,13-14,25H2,1-3H3,(H,26,27)(H,28,29,31) |
| InChIKey | QBQMGJPQKXJSFE-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 112.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.60 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|