C16H21ClN6O2S — CID 87985555
2-acetamido-4-[2-[4-(hydrazinylmethylideneamino)phenyl]ethyl]-N-methyl-1,3-thiazole-5-carboxamide;hydrochloride (PubChem CID 87985555) has the molecular formula C16H21ClN6O2S and a molecular weight of 396.90 g/mol. Its IUPAC name is 2-acetamido-4-[2-[4-(hydrazinylmethylideneamino)phenyl]ethyl]-N-methyl-1,3-thiazole-5-carboxamide;hydrochloride.
| Compound Name | 2-acetamido-4-[2-[4-(hydrazinylmethylideneamino)phenyl]ethyl]-N-methyl-1,3-thiazole-5-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 87985555 |
| Molecular Formula | C16H21ClN6O2S |
| Molecular Weight | 396.90 g/mol |
| Exact Mass | 396.11 |
| IUPAC Name | 2-acetamido-4-[2-[4-(hydrazinylmethylideneamino)phenyl]ethyl]-N-methyl-1,3-thiazole-5-carboxamide;hydrochloride |
| SMILES | CNC(=O)c1sc(NC(C)=O)nc1CCc1ccc(/N=C/NN)cc1.Cl |
| InChI | InChI=1S/C16H20N6O2S.ClH/c1-10(23)21-16-22-13(14(25-16)15(24)18-2)8-5-11-3-6-12(7-4-11)19-9-20-17;/h3-4,6-7,9H,5,8,17H2,1-2H3,(H,18,24)(H,19,20)(H,21,22,23);1H |
| InChIKey | KOYHNMDFBQTNFJ-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 121.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.90 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|