C22H29N7O3S — CID 58720277
(2R)-1-[2-acetamido-4-[2-[4-(diaminomethylideneamino)phenyl]ethyl]-1,3-thiazole-5-carbonyl]-N,N-dimethylpyrrolidine-2-carboxamide (PubChem CID 58720277) has the molecular formula C22H29N7O3S and a molecular weight of 471.59 g/mol. Its IUPAC name is (2R)-1-[2-acetamido-4-[2-[4-(diaminomethylideneamino)phenyl]ethyl]-1,3-thiazole-5-carbonyl]-N,N-dimethylpyrrolidine-2-carboxamide.
| Compound Name | (2R)-1-[2-acetamido-4-[2-[4-(diaminomethylideneamino)phenyl]ethyl]-1,3-thiazole-5-carbonyl]-N,N-dimethylpyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 58720277 |
| Molecular Formula | C22H29N7O3S |
| Molecular Weight | 471.59 g/mol |
| Exact Mass | 471.21 |
| IUPAC Name | (2R)-1-[2-acetamido-4-[2-[4-(diaminomethylideneamino)phenyl]ethyl]-1,3-thiazole-5-carbonyl]-N,N-dimethylpyrrolidine-2-carboxamide |
| SMILES | CC(=O)Nc1nc(CCc2ccc(N=C(N)N)cc2)c(C(=O)N2CCC[C@@H]2C(=O)N(C)C)s1 |
| InChI | InChI=1S/C22H29N7O3S/c1-13(30)25-22-27-16(11-8-14-6-9-15(10-7-14)26-21(23)24)18(33-22)20(32)29-12-4-5-17(29)19(31)28(2)3/h6-7,9-10,17H,4-5,8,11-12H2,1-3H3,(H4,23,24,26)(H,25,27,30)/t17-/m1/s1 |
| InChIKey | ISTBLSUGRBIDNI-QGZVFWFLSA-N |
| XLogP | 1.48 |
| TPSA | 147.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.59 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|