C19H25N7O2S2 — CID 89231747
N-[4-[2-[4-(diaminomethylideneamino)phenyl]ethyl]-5-(4-sulfanylpiperazine-1-carbonyl)-1,3-thiazol-2-yl]acetamide (PubChem CID 89231747) has the molecular formula C19H25N7O2S2 and a molecular weight of 447.59 g/mol. Its IUPAC name is N-[4-[2-[4-(diaminomethylideneamino)phenyl]ethyl]-5-(4-sulfanylpiperazine-1-carbonyl)-1,3-thiazol-2-yl]acetamide.
| Compound Name | N-[4-[2-[4-(diaminomethylideneamino)phenyl]ethyl]-5-(4-sulfanylpiperazine-1-carbonyl)-1,3-thiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 89231747 |
| Molecular Formula | C19H25N7O2S2 |
| Molecular Weight | 447.59 g/mol |
| Exact Mass | 447.15 |
| IUPAC Name | N-[4-[2-[4-(diaminomethylideneamino)phenyl]ethyl]-5-(4-sulfanylpiperazine-1-carbonyl)-1,3-thiazol-2-yl]acetamide |
| SMILES | CC(=O)Nc1nc(CCc2ccc(N=C(N)N)cc2)c(C(=O)N2CCN(S)CC2)s1 |
| InChI | InChI=1S/C19H25N7O2S2/c1-12(27)22-19-24-15(7-4-13-2-5-14(6-3-13)23-18(20)21)16(30-19)17(28)25-8-10-26(29)11-9-25/h2-3,5-6,29H,4,7-11H2,1H3,(H4,20,21,23)(H,22,24,27) |
| InChIKey | ORFQIHYMMZNSGT-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 129.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.59 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|