C24H25N7O8S — CID 173149597
[4-[2-[2-acetamido-5-[(4-nitrophenyl)methylcarbamoyl]-1,3-thiazol-4-yl]ethyl]phenyl]iminomethylcarbamic acid;carbamic acid (PubChem CID 173149597) has the molecular formula C24H25N7O8S and a molecular weight of 571.57 g/mol. Its IUPAC name is [4-[2-[2-acetamido-5-[(4-nitrophenyl)methylcarbamoyl]-1,3-thiazol-4-yl]ethyl]phenyl]iminomethylcarbamic acid;carbamic acid.
| Compound Name | [4-[2-[2-acetamido-5-[(4-nitrophenyl)methylcarbamoyl]-1,3-thiazol-4-yl]ethyl]phenyl]iminomethylcarbamic acid;carbamic acid |
|---|---|
| PubChem CID | 173149597 |
| Molecular Formula | C24H25N7O8S |
| Molecular Weight | 571.57 g/mol |
| Exact Mass | 571.15 |
| IUPAC Name | [4-[2-[2-acetamido-5-[(4-nitrophenyl)methylcarbamoyl]-1,3-thiazol-4-yl]ethyl]phenyl]iminomethylcarbamic acid;carbamic acid |
| SMILES | CC(=O)Nc1nc(CCc2ccc(/N=C/NC(=O)O)cc2)c(C(=O)NCc2ccc([N+](=O)[O-])cc2)s1.NC(=O)O |
| InChI | InChI=1S/C23H22N6O6S.CH3NO2/c1-14(30)27-22-28-19(11-6-15-2-7-17(8-3-15)25-13-26-23(32)33)20(36-22)21(31)24-12-16-4-9-18(10-5-16)29(34)35;2-1(3)4/h2-5,7-10,13H,6,11-12H2,1H3,(H,24,31)(H,25,26)(H,32,33)(H,27,28,30);2H2,(H,3,4) |
| InChIKey | ROHBWTOJRVBZSW-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 239.24 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.57 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|