C26H29N5O6S — CID 86608469
[4-[2-[2-acetamido-5-[(4-nitrophenyl)methylcarbamoyl]-1,3-thiazol-4-yl]ethyl]phenyl]-tert-butylcarbamic acid (PubChem CID 86608469) has the molecular formula C26H29N5O6S and a molecular weight of 539.61 g/mol. Its IUPAC name is [4-[2-[2-acetamido-5-[(4-nitrophenyl)methylcarbamoyl]-1,3-thiazol-4-yl]ethyl]phenyl]-tert-butylcarbamic acid.
| Compound Name | [4-[2-[2-acetamido-5-[(4-nitrophenyl)methylcarbamoyl]-1,3-thiazol-4-yl]ethyl]phenyl]-tert-butylcarbamic acid |
|---|---|
| PubChem CID | 86608469 |
| Molecular Formula | C26H29N5O6S |
| Molecular Weight | 539.61 g/mol |
| Exact Mass | 539.18 |
| IUPAC Name | [4-[2-[2-acetamido-5-[(4-nitrophenyl)methylcarbamoyl]-1,3-thiazol-4-yl]ethyl]phenyl]-tert-butylcarbamic acid |
| SMILES | CC(=O)Nc1nc(CCc2ccc(N(C(=O)O)C(C)(C)C)cc2)c(C(=O)NCc2ccc([N+](=O)[O-])cc2)s1 |
| InChI | InChI=1S/C26H29N5O6S/c1-16(32)28-24-29-21(14-9-17-5-10-19(11-6-17)30(25(34)35)26(2,3)4)22(38-24)23(33)27-15-18-7-12-20(13-8-18)31(36)37/h5-8,10-13H,9,14-15H2,1-4H3,(H,27,33)(H,34,35)(H,28,29,32) |
| InChIKey | WWGRVNJIBHSPRY-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 154.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.61 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|