C18H21N3O4S — CID 55899499
5-(2,2-dimethylpropanoylamino)-3-methyl-N-[(4-nitrophenyl)methyl]thiophene-2-carboxamide (PubChem CID 55899499) has the molecular formula C18H21N3O4S and a molecular weight of 375.45 g/mol. Its IUPAC name is 5-(2,2-dimethylpropanoylamino)-3-methyl-N-[(4-nitrophenyl)methyl]thiophene-2-carboxamide.
| Compound Name | 5-(2,2-dimethylpropanoylamino)-3-methyl-N-[(4-nitrophenyl)methyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 55899499 |
| Molecular Formula | C18H21N3O4S |
| Molecular Weight | 375.45 g/mol |
| Exact Mass | 375.13 |
| IUPAC Name | 5-(2,2-dimethylpropanoylamino)-3-methyl-N-[(4-nitrophenyl)methyl]thiophene-2-carboxamide |
| SMILES | Cc1cc(NC(=O)C(C)(C)C)sc1C(=O)NCc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C18H21N3O4S/c1-11-9-14(20-17(23)18(2,3)4)26-15(11)16(22)19-10-12-5-7-13(8-6-12)21(24)25/h5-9H,10H2,1-4H3,(H,19,22)(H,20,23) |
| InChIKey | APOBMPKOEUPPJA-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 101.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.45 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|