C21H28N4O5S — CID 86616189
[4-[2-[2-acetamido-5-[methoxy(methyl)carbamoyl]-1,3-thiazol-4-yl]ethyl]phenyl]-tert-butylcarbamic acid (PubChem CID 86616189) has the molecular formula C21H28N4O5S and a molecular weight of 448.55 g/mol. Its IUPAC name is [4-[2-[2-acetamido-5-[methoxy(methyl)carbamoyl]-1,3-thiazol-4-yl]ethyl]phenyl]-tert-butylcarbamic acid.
| Compound Name | [4-[2-[2-acetamido-5-[methoxy(methyl)carbamoyl]-1,3-thiazol-4-yl]ethyl]phenyl]-tert-butylcarbamic acid |
|---|---|
| PubChem CID | 86616189 |
| Molecular Formula | C21H28N4O5S |
| Molecular Weight | 448.55 g/mol |
| Exact Mass | 448.18 |
| IUPAC Name | [4-[2-[2-acetamido-5-[methoxy(methyl)carbamoyl]-1,3-thiazol-4-yl]ethyl]phenyl]-tert-butylcarbamic acid |
| SMILES | CON(C)C(=O)c1sc(NC(C)=O)nc1CCc1ccc(N(C(=O)O)C(C)(C)C)cc1 |
| InChI | InChI=1S/C21H28N4O5S/c1-13(26)22-19-23-16(17(31-19)18(27)24(5)30-6)12-9-14-7-10-15(11-8-14)25(20(28)29)21(2,3)4/h7-8,10-11H,9,12H2,1-6H3,(H,28,29)(H,22,23,26) |
| InChIKey | HKWHDCZUWVPOCX-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 112.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.55 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|