C19H23N7O3S — CID 143109778
2-acetamido-4-[2-[4-(diaminomethylideneamino)phenyl]ethyl]-N-[2-(dimethylamino)-2-oxoethylidene]-1,3-thiazole-5-carboxamide (PubChem CID 143109778) has the molecular formula C19H23N7O3S and a molecular weight of 429.51 g/mol. Its IUPAC name is 2-acetamido-4-[2-[4-(diaminomethylideneamino)phenyl]ethyl]-N-[2-(dimethylamino)-2-oxoethylidene]-1,3-thiazole-5-carboxamide.
| Compound Name | 2-acetamido-4-[2-[4-(diaminomethylideneamino)phenyl]ethyl]-N-[2-(dimethylamino)-2-oxoethylidene]-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 143109778 |
| Molecular Formula | C19H23N7O3S |
| Molecular Weight | 429.51 g/mol |
| Exact Mass | 429.16 |
| IUPAC Name | 2-acetamido-4-[2-[4-(diaminomethylideneamino)phenyl]ethyl]-N-[2-(dimethylamino)-2-oxoethylidene]-1,3-thiazole-5-carboxamide |
| SMILES | CC(=O)Nc1nc(CCc2ccc(N=C(N)N)cc2)c(C(=O)/N=C/C(=O)N(C)C)s1 |
| InChI | InChI=1S/C19H23N7O3S/c1-11(27)23-19-25-14(16(30-19)17(29)22-10-15(28)26(2)3)9-6-12-4-7-13(8-5-12)24-18(20)21/h4-5,7-8,10H,6,9H2,1-3H3,(H4,20,21,24)(H,23,25,27)/b22-10+ |
| InChIKey | HMNQYXBOUSODKM-LSHDLFTRSA-N |
| XLogP | 1.09 |
| TPSA | 156.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.51 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|