C24H28N6O4S2 — CID 11706391
N-[[2-acetamido-4-[2-[4-(diaminomethylideneamino)phenyl]ethyl]-1,3-thiazol-5-yl]methyl]-N-methyl-4-methylsulfonylbenzamide (PubChem CID 11706391) has the molecular formula C24H28N6O4S2 and a molecular weight of 528.66 g/mol. Its IUPAC name is N-[[2-acetamido-4-[2-[4-(diaminomethylideneamino)phenyl]ethyl]-1,3-thiazol-5-yl]methyl]-N-methyl-4-methylsulfonylbenzamide.
| Compound Name | N-[[2-acetamido-4-[2-[4-(diaminomethylideneamino)phenyl]ethyl]-1,3-thiazol-5-yl]methyl]-N-methyl-4-methylsulfonylbenzamide |
|---|---|
| PubChem CID | 11706391 |
| Molecular Formula | C24H28N6O4S2 |
| Molecular Weight | 528.66 g/mol |
| Exact Mass | 528.16 |
| IUPAC Name | N-[[2-acetamido-4-[2-[4-(diaminomethylideneamino)phenyl]ethyl]-1,3-thiazol-5-yl]methyl]-N-methyl-4-methylsulfonylbenzamide |
| SMILES | CC(=O)Nc1nc(CCc2ccc(N=C(N)N)cc2)c(CN(C)C(=O)c2ccc(S(C)(=O)=O)cc2)s1 |
| InChI | InChI=1S/C24H28N6O4S2/c1-15(31)27-24-29-20(13-6-16-4-9-18(10-5-16)28-23(25)26)21(35-24)14-30(2)22(32)17-7-11-19(12-8-17)36(3,33)34/h4-5,7-12H,6,13-14H2,1-3H3,(H4,25,26,28)(H,27,29,31) |
| InChIKey | OYSAISOGWWMOSE-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 160.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.66 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|