C23H25IN4O4S3 — CID 141229615
O-methyl N-[4-[2-[2-acetamido-5-[(4-methylsulfonylphenyl)methyl]-1,3-thiazol-4-yl]ethyl]phenyl]iminocarbamothioate;hydroiodide (PubChem CID 141229615) has the molecular formula C23H25IN4O4S3 and a molecular weight of 644.58 g/mol. Its IUPAC name is O-methyl N-[4-[2-[2-acetamido-5-[(4-methylsulfonylphenyl)methyl]-1,3-thiazol-4-yl]ethyl]phenyl]iminocarbamothioate;hydroiodide.
| Compound Name | O-methyl N-[4-[2-[2-acetamido-5-[(4-methylsulfonylphenyl)methyl]-1,3-thiazol-4-yl]ethyl]phenyl]iminocarbamothioate;hydroiodide |
|---|---|
| PubChem CID | 141229615 |
| Molecular Formula | C23H25IN4O4S3 |
| Molecular Weight | 644.58 g/mol |
| Exact Mass | 644.01 |
| IUPAC Name | O-methyl N-[4-[2-[2-acetamido-5-[(4-methylsulfonylphenyl)methyl]-1,3-thiazol-4-yl]ethyl]phenyl]iminocarbamothioate;hydroiodide |
| SMILES | COC(=S)/N=N/c1ccc(CCc2nc(NC(C)=O)sc2Cc2ccc(S(C)(=O)=O)cc2)cc1.I |
| InChI | InChI=1S/C23H24N4O4S3.HI/c1-15(28)24-22-25-20(13-8-16-4-9-18(10-5-16)26-27-23(32)31-2)21(33-22)14-17-6-11-19(12-7-17)34(3,29)30;/h4-7,9-12H,8,13-14H2,1-3H3,(H,24,25,28);1H/b27-26+; |
| InChIKey | WETROVKTTOSRKX-JGUILPGDSA-N |
| XLogP | 5.51 |
| TPSA | 110.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.58 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|